C25H28F3N5O4 — CID 145084048
methyl 2-[[(9S)-5-[(3R)-6,6,6-trifluoro-3,4-dimethylhexanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate (PubChem CID 145084048) has the molecular formula C25H28F3N5O4 and a molecular weight of 519.52 g/mol. Its IUPAC name is methyl 2-[[(9S)-5-[(3R)-6,6,6-trifluoro-3,4-dimethylhexanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate.
| Compound Name | methyl 2-[[(9S)-5-[(3R)-6,6,6-trifluoro-3,4-dimethylhexanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 145084048 |
| Molecular Formula | C25H28F3N5O4 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | methyl 2-[[(9S)-5-[(3R)-6,6,6-trifluoro-3,4-dimethylhexanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carbonyl]amino]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(NC(=O)N2c3nc(C(=O)C[C@@H](C)C(C)CC(F)(F)F)ccc3N3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C25H28F3N5O4/c1-14(15(2)12-25(26,27)28)10-20(34)18-4-5-19-22(30-18)33(17-7-9-32(19)13-17)24(36)31-21-11-16(6-8-29-21)23(35)37-3/h4-6,8,11,14-15,17H,7,9-10,12-13H2,1-3H3,(H,29,31,36)/t14-,15?,17+/m1/s1 |
| InChIKey | HOAYZEMRHVLYIL-BZEOVNSFSA-N |
| XLogP | 4.69 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |