C31H37F2N5 — CID 145087148
(1S)-6-[2-[3-[(1E)-1-[ethynyl(methyl)amino]buta-1,3-dien-2-yl]phenyl]-5-[(Z)-1-methyliminohex-2-en-2-yl]pyrimidin-4-yl]-3,3-difluorocycloheptan-1-amine (PubChem CID 145087148) has the molecular formula C31H37F2N5 and a molecular weight of 517.67 g/mol. Its IUPAC name is (1S)-6-[2-[3-[(1E)-1-[ethynyl(methyl)amino]buta-1,3-dien-2-yl]phenyl]-5-[(Z)-1-methyliminohex-2-en-2-yl]pyrimidin-4-yl]-3,3-difluorocycloheptan-1-amine.
| Compound Name | (1S)-6-[2-[3-[(1E)-1-[ethynyl(methyl)amino]buta-1,3-dien-2-yl]phenyl]-5-[(Z)-1-methyliminohex-2-en-2-yl]pyrimidin-4-yl]-3,3-difluorocycloheptan-1-amine |
|---|---|
| PubChem CID | 145087148 |
| Molecular Formula | C31H37F2N5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | (1S)-6-[2-[3-[(1E)-1-[ethynyl(methyl)amino]buta-1,3-dien-2-yl]phenyl]-5-[(Z)-1-methyliminohex-2-en-2-yl]pyrimidin-4-yl]-3,3-difluorocycloheptan-1-amine |
| SMILES | C#CN(C)/C=C(\C=C)c1cccc(-c2ncc(C(/C=N\C)=C/CCC)c(C3CCC(F)(F)C[C@@H](N)C3)n2)c1 |
| InChI | InChI=1S/C31H37F2N5/c1-6-9-11-26(19-35-4)28-20-36-30(37-29(28)24-14-15-31(32,33)18-27(34)17-24)25-13-10-12-23(16-25)22(7-2)21-38(5)8-3/h3,7,10-13,16,19-21,24,27H,2,6,9,14-15,17-18,34H2,1,4-5H3/b22-21+,26-11+,35-19-/t24?,27-/m0/s1 |
| InChIKey | KESPXJWRDLKBDP-BOSQJWRQSA-N |
| XLogP | 6.70 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|