C22H37N3O3 — CID 145089637
[2-methoxy-4-[[[(E)-8-methylnon-6-enyl]amino]methyl]phenyl] N-(2-aminoethyl)-N-methylcarbamate (PubChem CID 145089637) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is [2-methoxy-4-[[[(E)-8-methylnon-6-enyl]amino]methyl]phenyl] N-(2-aminoethyl)-N-methylcarbamate.
| Compound Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enyl]amino]methyl]phenyl] N-(2-aminoethyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 145089637 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | [2-methoxy-4-[[[(E)-8-methylnon-6-enyl]amino]methyl]phenyl] N-(2-aminoethyl)-N-methylcarbamate |
| SMILES | COc1cc(CNCCCCC/C=C/C(C)C)ccc1OC(=O)N(C)CCN |
| InChI | InChI=1S/C22H37N3O3/c1-18(2)10-8-6-5-7-9-14-24-17-19-11-12-20(21(16-19)27-4)28-22(26)25(3)15-13-23/h8,10-12,16,18,24H,5-7,9,13-15,17,23H2,1-4H3/b10-8+ |
| InChIKey | VWHRTGNMCUZLLF-CSKARUKUSA-N |
| XLogP | 3.95 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|