C26H46OS — CID 145090202
(6S,9S)-6-ethyl-17-(4-hydroxysulfanylbutyl)-10,13,17-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 145090202) has the molecular formula C26H46OS and a molecular weight of 406.72 g/mol. Its IUPAC name is (6S,9S)-6-ethyl-17-(4-hydroxysulfanylbutyl)-10,13,17-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (6S,9S)-6-ethyl-17-(4-hydroxysulfanylbutyl)-10,13,17-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 145090202 |
| Molecular Formula | C26H46OS |
| Molecular Weight | 406.72 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (6S,9S)-6-ethyl-17-(4-hydroxysulfanylbutyl)-10,13,17-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | CC[C@H]1CC2C3CCC(C)(CCCCSO)C3(C)CC[C@@H]2C2(C)CCCCC12 |
| InChI | InChI=1S/C26H46OS/c1-5-19-18-20-22(25(3)14-7-6-10-21(19)25)12-16-26(4)23(20)11-15-24(26,2)13-8-9-17-28-27/h19-23,27H,5-18H2,1-4H3/t19-,20?,21?,22-,23?,24?,25?,26?/m0/s1 |
| InChIKey | AGTIQWBVTOLHJA-USHMUBFTSA-N |
| XLogP | 8.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.72 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|