C18H32N4OS — CID 145093113
5-[4,5-dimethyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazol-2-yl]pyridin-2-amine;ethane (PubChem CID 145093113) has the molecular formula C18H32N4OS and a molecular weight of 352.55 g/mol. Its IUPAC name is 5-[4,5-dimethyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazol-2-yl]pyridin-2-amine;ethane.
| Compound Name | 5-[4,5-dimethyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazol-2-yl]pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 145093113 |
| Molecular Formula | C18H32N4OS |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 5-[4,5-dimethyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazol-2-yl]pyridin-2-amine;ethane |
| SMILES | CC.Cc1nc(-c2ccc(N)nc2)n(COCCS(C)(C)C)c1C |
| InChI | InChI=1S/C16H26N4OS.C2H6/c1-12-13(2)20(11-21-8-9-22(3,4)5)16(19-12)14-6-7-15(17)18-10-14;1-2/h6-7,10H,8-9,11H2,1-5H3,(H2,17,18);1-2H3 |
| InChIKey | RCNYYANHCLPQRF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|