C10H18N2 — CID 145093693
ethane;(Z)-4-methylidenehept-2-ene-1,5-diimine (PubChem CID 145093693) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;(Z)-4-methylidenehept-2-ene-1,5-diimine.
| Compound Name | ethane;(Z)-4-methylidenehept-2-ene-1,5-diimine |
|---|---|
| PubChem CID | 145093693 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethane;(Z)-4-methylidenehept-2-ene-1,5-diimine |
| SMILES | CC.[H]/N=C/C=C\C(=C)/C(CC)=N/[H] |
| InChI | InChI=1S/C8H12N2.C2H6/c1-3-8(10)7(2)5-4-6-9;1-2/h4-6,9-10H,2-3H2,1H3;1-2H3/b5-4-,9-6+,10-8+; |
| InChIKey | QYKHNOMPQYCBJF-IITBDRACSA-N |
| XLogP | 3.20 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|