C8H11F3O3 — CID 145105705
(3aR,6aS)-6-(2,2,2-trifluoroethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 145105705) has the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. Its IUPAC name is (3aR,6aS)-6-(2,2,2-trifluoroethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3aR,6aS)-6-(2,2,2-trifluoroethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 145105705 |
| Molecular Formula | C8H11F3O3 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (3aR,6aS)-6-(2,2,2-trifluoroethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | FC(F)(F)COC1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C8H11F3O3/c9-8(10,11)4-14-6-3-13-5-1-2-12-7(5)6/h5-7H,1-4H2/t5-,6?,7+/m1/s1 |
| InChIKey | QVFMZVBNDPLCMK-UYMSWOSGSA-N |
| XLogP | 1.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |