C22H27FN6O2 — CID 145106899
(4-cyclopropylphenyl)methyl (3S,4R)-3-fluoro-4-[[(3-imino-4-methanimidoylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate (PubChem CID 145106899) has the molecular formula C22H27FN6O2 and a molecular weight of 426.50 g/mol. Its IUPAC name is (4-cyclopropylphenyl)methyl (3S,4R)-3-fluoro-4-[[(3-imino-4-methanimidoylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | (4-cyclopropylphenyl)methyl (3S,4R)-3-fluoro-4-[[(3-imino-4-methanimidoylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145106899 |
| Molecular Formula | C22H27FN6O2 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (4-cyclopropylphenyl)methyl (3S,4R)-3-fluoro-4-[[(3-imino-4-methanimidoylpyrazin-2-yl)amino]methyl]piperidine-1-carboxylate |
| SMILES | [H]/N=C/n1ccnc(NC[C@H]2CCN(C(=O)OCc3ccc(C4CC4)cc3)C[C@H]2F)/c1=N\[H] |
| InChI | InChI=1S/C22H27FN6O2/c23-19-12-28(22(30)31-13-15-1-3-16(4-2-15)17-5-6-17)9-7-18(19)11-27-21-20(25)29(14-24)10-8-26-21/h1-4,8,10,14,17-19,24-25H,5-7,9,11-13H2,(H,26,27)/b24-14+,25-20+/t18-,19-/m1/s1 |
| InChIKey | NALGRALRVUXPFH-GKTBAPCZSA-N |
| XLogP | 3.10 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|