C28H22IN — CID 145108250
2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)-5-(4-methylphenyl)-3,4-diphenyl-1H-pyrrole (PubChem CID 145108250) has the molecular formula C28H22IN and a molecular weight of 499.40 g/mol. Its IUPAC name is 2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)-5-(4-methylphenyl)-3,4-diphenyl-1H-pyrrole.
| Compound Name | 2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)-5-(4-methylphenyl)-3,4-diphenyl-1H-pyrrole |
|---|---|
| PubChem CID | 145108250 |
| Molecular Formula | C28H22IN |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 2-(1λ3-iodacyclohexa-1,3,5-trien-4-yl)-5-(4-methylphenyl)-3,4-diphenyl-1H-pyrrole |
| SMILES | Cc1ccc(-c2[nH]c(C3=CC=IC=C3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22IN/c1-20-12-14-23(15-13-20)27-25(21-8-4-2-5-9-21)26(22-10-6-3-7-11-22)28(30-27)24-16-18-29-19-17-24/h2-19,30H,1H3 |
| InChIKey | YOPZFMZVPVDMMW-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|