C13H14F2O — CID 145111152
4-(difluoromethoxy)-2-prop-1-en-2-yl-2,3-dihydro-1H-indene (PubChem CID 145111152) has the molecular formula C13H14F2O and a molecular weight of 224.25 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2-prop-1-en-2-yl-2,3-dihydro-1H-indene.
| Compound Name | 4-(difluoromethoxy)-2-prop-1-en-2-yl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 145111152 |
| Molecular Formula | C13H14F2O |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-(difluoromethoxy)-2-prop-1-en-2-yl-2,3-dihydro-1H-indene |
| SMILES | C=C(C)C1Cc2cccc(OC(F)F)c2C1 |
| InChI | InChI=1S/C13H14F2O/c1-8(2)10-6-9-4-3-5-12(11(9)7-10)16-13(14)15/h3-5,10,13H,1,6-7H2,2H3 |
| InChIKey | JTMXFQOKZKVBCD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|