C20H26N2OS — CID 145112904
1,2,2-trimethyl-4-[4-(4-methylphenyl)sulfanyloxyphenyl]piperazine (PubChem CID 145112904) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 1,2,2-trimethyl-4-[4-(4-methylphenyl)sulfanyloxyphenyl]piperazine.
| Compound Name | 1,2,2-trimethyl-4-[4-(4-methylphenyl)sulfanyloxyphenyl]piperazine |
|---|---|
| PubChem CID | 145112904 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1,2,2-trimethyl-4-[4-(4-methylphenyl)sulfanyloxyphenyl]piperazine |
| SMILES | Cc1ccc(SOc2ccc(N3CCN(C)C(C)(C)C3)cc2)cc1 |
| InChI | InChI=1S/C20H26N2OS/c1-16-5-11-19(12-6-16)24-23-18-9-7-17(8-10-18)22-14-13-21(4)20(2,3)15-22/h5-12H,13-15H2,1-4H3 |
| InChIKey | NXAREWHLAFDIEB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|