C25H33ClIN3O5 — CID 145119669
(2R)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-iodo-3-methyl-2H-triazol-1-yl]propan-2-ol (PubChem CID 145119669) has the molecular formula C25H33ClIN3O5 and a molecular weight of 617.91 g/mol. Its IUPAC name is (2R)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-iodo-3-methyl-2H-triazol-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-iodo-3-methyl-2H-triazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 145119669 |
| Molecular Formula | C25H33ClIN3O5 |
| Molecular Weight | 617.91 g/mol |
| Exact Mass | 617.12 |
| IUPAC Name | (2R)-1-[4-[2-[4-[(2S)-3-chloro-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-3-[5-(hydroxymethyl)-4-iodo-3-methyl-2H-triazol-1-yl]propan-2-ol |
| SMILES | CN1NN(C[C@@H](O)COc2ccc(C(C)(C)c3ccc(OC[C@H](O)CCl)cc3)cc2)C(CO)=C1I |
| InChI | InChI=1S/C25H33ClIN3O5/c1-25(2,17-4-8-21(9-5-17)34-15-19(32)12-26)18-6-10-22(11-7-18)35-16-20(33)13-30-23(14-31)24(27)29(3)28-30/h4-11,19-20,28,31-33H,12-16H2,1-3H3/t19-,20-/m1/s1 |
| InChIKey | KSEHWDGGABQTNC-WOJBJXKFSA-N |
| XLogP | 2.99 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.91 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|