C27H40ClN3O4 — CID 145119810
1-chloro-3-[4-[2-[4-[3-[4-(hydroxymethyl)-5-methyl-1,2-dihydrotriazol-3-yl]propoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol;ethane (PubChem CID 145119810) has the molecular formula C27H40ClN3O4 and a molecular weight of 506.09 g/mol. Its IUPAC name is 1-chloro-3-[4-[2-[4-[3-[4-(hydroxymethyl)-5-methyl-1,2-dihydrotriazol-3-yl]propoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol;ethane.
| Compound Name | 1-chloro-3-[4-[2-[4-[3-[4-(hydroxymethyl)-5-methyl-1,2-dihydrotriazol-3-yl]propoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol;ethane |
|---|---|
| PubChem CID | 145119810 |
| Molecular Formula | C27H40ClN3O4 |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 1-chloro-3-[4-[2-[4-[3-[4-(hydroxymethyl)-5-methyl-1,2-dihydrotriazol-3-yl]propoxy]phenyl]propan-2-yl]phenoxy]propan-2-ol;ethane |
| SMILES | CC.CC1=C(CO)N(CCCOc2ccc(C(C)(C)c3ccc(OCC(O)CCl)cc3)cc2)NN1 |
| InChI | InChI=1S/C25H34ClN3O4.C2H6/c1-18-24(16-30)29(28-27-18)13-4-14-32-22-9-5-19(6-10-22)25(2,3)20-7-11-23(12-8-20)33-17-21(31)15-26;1-2/h5-12,21,27-28,30-31H,4,13-17H2,1-3H3;1-2H3 |
| InChIKey | DTFQBLFJERUBOB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|