C37H58O3 — CID 145122701
(4E,8Z,12Z)-8-ethyl-4-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;formaldehyde;2-methylprop-1-ene (PubChem CID 145122701) has the molecular formula C37H58O3 and a molecular weight of 550.87 g/mol. Its IUPAC name is (4E,8Z,12Z)-8-ethyl-4-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;formaldehyde;2-methylprop-1-ene.
| Compound Name | (4E,8Z,12Z)-8-ethyl-4-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;formaldehyde;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145122701 |
| Molecular Formula | C37H58O3 |
| Molecular Weight | 550.87 g/mol |
| Exact Mass | 550.44 |
| IUPAC Name | (4E,8Z,12Z)-8-ethyl-4-(2-methoxyethoxy)-15,18-dimethyl-3,6,7,10,11,14-hexamethylidenenonadeca-4,8,12-triene;formaldehyde;2-methylprop-1-ene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C)C(=C)/C=C(/CC)C(=C)C(=C)/C=C(/OCCOC)C(=C)CC.C=C(C)C.C=O |
| InChI | InChI=1S/C32H48O2.C4H8.CH2O/c1-13-24(5)32(34-20-19-33-12)22-29(10)30(11)31(14-2)21-28(9)27(8)18-17-26(7)25(6)16-15-23(3)4;1-4(2)3;1-2/h17-18,21-23,25H,5,7-11,13-16,19-20H2,1-4,6,12H3;1H2,2-3H3;1H2/b18-17-,31-21-,32-22+;; |
| InChIKey | VAXJPWXTFGCDRC-JEQNWDGYSA-N |
| XLogP | 10.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.87 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|