C10H13N3OS — CID 145125073
ethane;7-methoxy-1H-1,2,3-benzotriazine-4-thione (PubChem CID 145125073) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is ethane;7-methoxy-1H-1,2,3-benzotriazine-4-thione.
| Compound Name | ethane;7-methoxy-1H-1,2,3-benzotriazine-4-thione |
|---|---|
| PubChem CID | 145125073 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | ethane;7-methoxy-1H-1,2,3-benzotriazine-4-thione |
| SMILES | CC.COc1ccc2c(=S)nn[nH]c2c1 |
| InChI | InChI=1S/C8H7N3OS.C2H6/c1-12-5-2-3-6-7(4-5)9-11-10-8(6)13;1-2/h2-4H,1H3,(H,9,10,13);1-2H3 |
| InChIKey | TWDPOBYPOLCSDH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|