C19H22Cl2FN3O2S — CID 145131872
3-chloro-4-[1-(5-chloro-3-pyridinyl)piperidin-4-yl]oxy-N-methylsulfanylbenzamide;fluoromethane (PubChem CID 145131872) has the molecular formula C19H22Cl2FN3O2S and a molecular weight of 446.38 g/mol. Its IUPAC name is 3-chloro-4-[1-(5-chloro-3-pyridinyl)piperidin-4-yl]oxy-N-methylsulfanylbenzamide;fluoromethane.
| Compound Name | 3-chloro-4-[1-(5-chloro-3-pyridinyl)piperidin-4-yl]oxy-N-methylsulfanylbenzamide;fluoromethane |
|---|---|
| PubChem CID | 145131872 |
| Molecular Formula | C19H22Cl2FN3O2S |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 3-chloro-4-[1-(5-chloro-3-pyridinyl)piperidin-4-yl]oxy-N-methylsulfanylbenzamide;fluoromethane |
| SMILES | CF.CSNC(=O)c1ccc(OC2CCN(c3cncc(Cl)c3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2N3O2S.CH3F/c1-26-22-18(24)12-2-3-17(16(20)8-12)25-15-4-6-23(7-5-15)14-9-13(19)10-21-11-14;1-2/h2-3,8-11,15H,4-7H2,1H3,(H,22,24);1H3 |
| InChIKey | WTWKIERPMWSARW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|