C21H35N3O2 — CID 145142320
3-amino-4-(2-methyl-5-morpholin-4-yl-1H-indol-3-yl)but-1-en-2-ol;ethane (PubChem CID 145142320) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is 3-amino-4-(2-methyl-5-morpholin-4-yl-1H-indol-3-yl)but-1-en-2-ol;ethane.
| Compound Name | 3-amino-4-(2-methyl-5-morpholin-4-yl-1H-indol-3-yl)but-1-en-2-ol;ethane |
|---|---|
| PubChem CID | 145142320 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | 3-amino-4-(2-methyl-5-morpholin-4-yl-1H-indol-3-yl)but-1-en-2-ol;ethane |
| SMILES | C=C(O)C(N)Cc1c(C)[nH]c2ccc(N3CCOCC3)cc12.CC.CC |
| InChI | InChI=1S/C17H23N3O2.2C2H6/c1-11-14(10-16(18)12(2)21)15-9-13(3-4-17(15)19-11)20-5-7-22-8-6-20;2*1-2/h3-4,9,16,19,21H,2,5-8,10,18H2,1H3;2*1-2H3 |
| InChIKey | YGLHAPVWSUZETB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|