C13H24N2O — CID 145148026
(3,3-dimethylazetidin-1-yl)-(3-methyl-2,5-dihydropyrrol-1-yl)methanone;ethane (PubChem CID 145148026) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (3,3-dimethylazetidin-1-yl)-(3-methyl-2,5-dihydropyrrol-1-yl)methanone;ethane.
| Compound Name | (3,3-dimethylazetidin-1-yl)-(3-methyl-2,5-dihydropyrrol-1-yl)methanone;ethane |
|---|---|
| PubChem CID | 145148026 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (3,3-dimethylazetidin-1-yl)-(3-methyl-2,5-dihydropyrrol-1-yl)methanone;ethane |
| SMILES | CC.CC1=CCN(C(=O)N2CC(C)(C)C2)C1 |
| InChI | InChI=1S/C11H18N2O.C2H6/c1-9-4-5-12(6-9)10(14)13-7-11(2,3)8-13;1-2/h4H,5-8H2,1-3H3;1-2H3 |
| InChIKey | FDJAQQCPEMQBKU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|