C29H37F3N2O13 — CID 145161918
(Z)-7-[(1R,3R,5S)-2-[(E,3R)-3-(5,6-dinitrooxyhexanoyloxy)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 145161918) has the molecular formula C29H37F3N2O13 and a molecular weight of 678.61 g/mol. Its IUPAC name is (Z)-7-[(1R,3R,5S)-2-[(E,3R)-3-(5,6-dinitrooxyhexanoyloxy)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,3R,5S)-2-[(E,3R)-3-(5,6-dinitrooxyhexanoyloxy)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 145161918 |
| Molecular Formula | C29H37F3N2O13 |
| Molecular Weight | 678.61 g/mol |
| Exact Mass | 678.22 |
| IUPAC Name | (Z)-7-[(1R,3R,5S)-2-[(E,3R)-3-(5,6-dinitrooxyhexanoyloxy)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1C(/C=C/[C@H](COc2cccc(C(F)(F)F)c2)OC(=O)CCCC(CO[N+](=O)[O-])O[N+](=O)[O-])[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C29H37F3N2O13/c30-29(31,32)19-7-5-8-20(15-19)44-17-21(46-28(39)12-6-9-22(47-34(42)43)18-45-33(40)41)13-14-24-23(25(35)16-26(24)36)10-3-1-2-4-11-27(37)38/h1,3,5,7-8,13-15,21-26,35-36H,2,4,6,9-12,16-18H2,(H,37,38)/b3-1-,14-13+/t21-,22?,23-,24?,25+,26-/m1/s1 |
| InChIKey | FFWSXVGWRJEZIN-UKNNZBBPSA-N |
| XLogP | 4.07 |
| TPSA | 218.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|