C24H40 — CID 145162822
ethane;2-[1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]cyclopentyl]cyclohepta-1,3,5-triene;methane (PubChem CID 145162822) has the molecular formula C24H40 and a molecular weight of 328.58 g/mol. Its IUPAC name is ethane;2-[1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]cyclopentyl]cyclohepta-1,3,5-triene;methane.
| Compound Name | ethane;2-[1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]cyclopentyl]cyclohepta-1,3,5-triene;methane |
|---|---|
| PubChem CID | 145162822 |
| Molecular Formula | C24H40 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.31 |
| IUPAC Name | ethane;2-[1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]cyclopentyl]cyclohepta-1,3,5-triene;methane |
| SMILES | C.C=C/C=C\C(=C/C)C1(C2=CCC=CC=C2)CCCC1.CC.CC |
| InChI | InChI=1S/C19H24.2C2H6.CH4/c1-3-5-12-17(4-2)19(15-10-11-16-19)18-13-8-6-7-9-14-18;2*1-2;/h3-8,12-14H,1,9-11,15-16H2,2H3;2*1-2H3;1H4/b12-5-,17-4+;;; |
| InChIKey | MLUREMGAFJKKRG-KYKFXWNGSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|