C25H39N — CID 145365921
(2E,4Z)-N-[(1Z,2Z)-1-cyclohexa-2,4-dien-1-ylidenepenta-2,4-dienyl]hepta-2,4,6-trien-3-amine;2,2-dimethylpropane;ethane (PubChem CID 145365921) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is (2E,4Z)-N-[(1Z,2Z)-1-cyclohexa-2,4-dien-1-ylidenepenta-2,4-dienyl]hepta-2,4,6-trien-3-amine;2,2-dimethylpropane;ethane.
| Compound Name | (2E,4Z)-N-[(1Z,2Z)-1-cyclohexa-2,4-dien-1-ylidenepenta-2,4-dienyl]hepta-2,4,6-trien-3-amine;2,2-dimethylpropane;ethane |
|---|---|
| PubChem CID | 145365921 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | (2E,4Z)-N-[(1Z,2Z)-1-cyclohexa-2,4-dien-1-ylidenepenta-2,4-dienyl]hepta-2,4,6-trien-3-amine;2,2-dimethylpropane;ethane |
| SMILES | C=C/C=C\C(NC(/C=C\C=C)=C/C)=C1\C=CC=CC1.CC.CC(C)(C)C |
| InChI | InChI=1S/C18H21N.C5H12.C2H6/c1-4-7-14-17(6-3)19-18(15-8-5-2)16-12-10-9-11-13-16;1-5(2,3)4;1-2/h4-12,14-15,19H,1-2,13H2,3H3;1-4H3;1-2H3/b14-7-,15-8-,17-6+,18-16+;; |
| InChIKey | IZMRZGOHMXBJDT-ISJZLCIQSA-N |
| XLogP | 7.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|