C22H21N3S3 — CID 145170881
4-phenyl-2-piperidin-1-ylsulfanyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine (PubChem CID 145170881) has the molecular formula C22H21N3S3 and a molecular weight of 423.63 g/mol. Its IUPAC name is 4-phenyl-2-piperidin-1-ylsulfanyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine.
| Compound Name | 4-phenyl-2-piperidin-1-ylsulfanyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 145170881 |
| Molecular Formula | C22H21N3S3 |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 4-phenyl-2-piperidin-1-ylsulfanyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine |
| SMILES | Nc1c(SN2CCCCC2)sc2nc(-c3cccs3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C22H21N3S3/c23-20-19-16(15-8-3-1-4-9-15)14-17(18-10-7-13-26-18)24-21(19)27-22(20)28-25-11-5-2-6-12-25/h1,3-4,7-10,13-14H,2,5-6,11-12,23H2 |
| InChIKey | YZUBVPIUWOBBGU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|