C19H14BrN5S2 — CID 52998080
13-phenyl-11-thiophen-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4,6-diamine;hydrobromide (PubChem CID 52998080) has the molecular formula C19H14BrN5S2 and a molecular weight of 456.39 g/mol. Its IUPAC name is 13-phenyl-11-thiophen-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4,6-diamine;hydrobromide.
| Compound Name | 13-phenyl-11-thiophen-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4,6-diamine;hydrobromide |
|---|---|
| PubChem CID | 52998080 |
| Molecular Formula | C19H14BrN5S2 |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | 13-phenyl-11-thiophen-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4,6-diamine;hydrobromide |
| SMILES | Br.Nc1nc(N)c2sc3nc(-c4cccs4)cc(-c4ccccc4)c3c2n1 |
| InChI | InChI=1S/C19H13N5S2.BrH/c20-17-16-15(23-19(21)24-17)14-11(10-5-2-1-3-6-10)9-12(22-18(14)26-16)13-7-4-8-25-13;/h1-9H,(H4,20,21,23,24);1H |
| InChIKey | LBSYCPZEJVXINQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |