C14H18Cl2FNO2 — CID 145194296
2-(3,5-dichloro-2-fluorophenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanol (PubChem CID 145194296) has the molecular formula C14H18Cl2FNO2 and a molecular weight of 322.21 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-fluorophenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanol.
| Compound Name | 2-(3,5-dichloro-2-fluorophenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 145194296 |
| Molecular Formula | C14H18Cl2FNO2 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-(3,5-dichloro-2-fluorophenyl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanol |
| SMILES | OCC1CCN(C(CO)c2cc(Cl)cc(Cl)c2F)CC1 |
| InChI | InChI=1S/C14H18Cl2FNO2/c15-10-5-11(14(17)12(16)6-10)13(8-20)18-3-1-9(7-19)2-4-18/h5-6,9,13,19-20H,1-4,7-8H2 |
| InChIKey | GJLRBWGVKJHZDP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|