C18H39N3O — CID 145198283
2-[2-[[(2E,4Z)-5-amino-2-ethylhexa-2,4-dienyl]-ethylamino]ethyl-ethylamino]ethanol;ethane (PubChem CID 145198283) has the molecular formula C18H39N3O and a molecular weight of 313.53 g/mol. Its IUPAC name is 2-[2-[[(2E,4Z)-5-amino-2-ethylhexa-2,4-dienyl]-ethylamino]ethyl-ethylamino]ethanol;ethane.
| Compound Name | 2-[2-[[(2E,4Z)-5-amino-2-ethylhexa-2,4-dienyl]-ethylamino]ethyl-ethylamino]ethanol;ethane |
|---|---|
| PubChem CID | 145198283 |
| Molecular Formula | C18H39N3O |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.31 |
| IUPAC Name | 2-[2-[[(2E,4Z)-5-amino-2-ethylhexa-2,4-dienyl]-ethylamino]ethyl-ethylamino]ethanol;ethane |
| SMILES | CC.CC/C(=C\C=C(\C)N)CN(CC)CCN(CC)CCO |
| InChI | InChI=1S/C16H33N3O.C2H6/c1-5-16(9-8-15(4)17)14-19(7-3)11-10-18(6-2)12-13-20;1-2/h8-9,20H,5-7,10-14,17H2,1-4H3;1-2H3/b15-8-,16-9+; |
| InChIKey | NFENSTXVGZWOBD-LPKPCKJCSA-N |
| XLogP | 2.85 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|