C18H13ClO2 — CID 145218435
3-[(1Z,3E)-4-chloropenta-1,3-dienyl]xanthen-9-one (PubChem CID 145218435) has the molecular formula C18H13ClO2 and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-[(1Z,3E)-4-chloropenta-1,3-dienyl]xanthen-9-one.
| Compound Name | 3-[(1Z,3E)-4-chloropenta-1,3-dienyl]xanthen-9-one |
|---|---|
| PubChem CID | 145218435 |
| Molecular Formula | C18H13ClO2 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-[(1Z,3E)-4-chloropenta-1,3-dienyl]xanthen-9-one |
| SMILES | C/C(Cl)=C\C=C/c1ccc2c(=O)c3ccccc3oc2c1 |
| InChI | InChI=1S/C18H13ClO2/c1-12(19)5-4-6-13-9-10-15-17(11-13)21-16-8-3-2-7-14(16)18(15)20/h2-11H,1H3/b6-4-,12-5+ |
| InChIKey | AMRSDAGUFMASCW-GLNLJRCCSA-N |
| XLogP | 5.10 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|