C46H52ClNO11 — CID 145232339
[5-chloro-2-hydroxy-4-[[4-[2-hydroxy-1-[4-(4-prop-2-enoyloxybutoxy)phenyl]ethenoxy]phenyl]methylideneamino]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate;ethane (PubChem CID 145232339) has the molecular formula C46H52ClNO11 and a molecular weight of 830.37 g/mol. Its IUPAC name is [5-chloro-2-hydroxy-4-[[4-[2-hydroxy-1-[4-(4-prop-2-enoyloxybutoxy)phenyl]ethenoxy]phenyl]methylideneamino]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate;ethane.
| Compound Name | [5-chloro-2-hydroxy-4-[[4-[2-hydroxy-1-[4-(4-prop-2-enoyloxybutoxy)phenyl]ethenoxy]phenyl]methylideneamino]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate;ethane |
|---|---|
| PubChem CID | 145232339 |
| Molecular Formula | C46H52ClNO11 |
| Molecular Weight | 830.37 g/mol |
| Exact Mass | 829.32 |
| IUPAC Name | [5-chloro-2-hydroxy-4-[[4-[2-hydroxy-1-[4-(4-prop-2-enoyloxybutoxy)phenyl]ethenoxy]phenyl]methylideneamino]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate;ethane |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2cc(Cl)c(/N=C/c3ccc(OC(=CO)c4ccc(OCCCCOC(=O)C=C)cc4)cc3)cc2O)cc1.CC.CC |
| InChI | InChI=1S/C42H40ClNO11.2C2H6/c1-3-40(47)52-23-7-5-21-50-32-17-11-30(12-18-32)39(28-45)54-34-15-9-29(10-16-34)27-44-36-26-37(46)38(25-35(36)43)55-42(49)31-13-19-33(20-14-31)51-22-6-8-24-53-41(48)4-2;2*1-2/h3-4,9-20,25-28,45-46H,1-2,5-8,21-24H2;2*1-2H3/b39-28?,44-27+;; |
| InChIKey | IVEZZXDYJQQQTP-QFZFOSMRSA-N |
| XLogP | 10.78 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.37 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|