C21H21F3O3 — CID 145233817
2-[2,4-difluoro-6-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]-6-ethyloxan-4-ol (PubChem CID 145233817) has the molecular formula C21H21F3O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is 2-[2,4-difluoro-6-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]-6-ethyloxan-4-ol.
| Compound Name | 2-[2,4-difluoro-6-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]-6-ethyloxan-4-ol |
|---|---|
| PubChem CID | 145233817 |
| Molecular Formula | C21H21F3O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-[2,4-difluoro-6-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]-6-ethyloxan-4-ol |
| SMILES | CCC1CC(O)CC(Oc2c(F)cc(F)cc2/C=C/c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C21H21F3O3/c1-2-18-11-17(25)12-20(26-18)27-21-14(9-16(23)10-19(21)24)6-3-13-4-7-15(22)8-5-13/h3-10,17-18,20,25H,2,11-12H2,1H3/b6-3+ |
| InChIKey | BDCBOAVYQOHUET-ZZXKWVIFSA-N |
| XLogP | 4.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|