About 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol
2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol (PubChem CID 145261710) has the molecular formula C21H44O4
and a molecular weight of 360.58 g/mol. Its IUPAC name is 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol.
Molecular Properties
| Compound Name | 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol |
| PubChem CID | 145261710 |
| Molecular Formula | C21H44O4 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol |
| SMILES | CCCCC(CC)CO.CCCCC(CC)COC1COCC(O)C1 |
| InChI | InChI=1S/C13H26O3.C8H18O/c1-3-5-6-11(4-2)8-16-13-7-12(14)9-15-10-13;1-3-5-6-8(4-2)7-9/h11-14H,3-10H2,1-2H3;8-9H,3-7H2,1-2H3 |
| InChIKey | DNYLIHMNXCCXMV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol?
The IUPAC name of 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol (CID 145261710) is 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol.
What is the SMILES notation for 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol?
The canonical SMILES for 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol is CCCCC(CC)CO.CCCCC(CC)COC1COCC(O)C1.
What is the InChIKey of 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol?
The InChIKey is DNYLIHMNXCCXMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3.C8H18O/c1-3-5-6-11(4-2)8-16-13-7-12(14)9-15-10-13;1-3-5-6-8(4-2)7-9/h11-14H,3-10H2,1-2H3;8-9H,3-7H2,1-2H3.
What are the key properties of 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol?
2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol has a molecular weight of 360.58 g/mol, XLogP of 4.56, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexan-1-ol;5-(2-ethylhexoxy)oxan-3-ol is sourced from PubChem (CID 145261710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).