C31H56N4O5S — CID 145262629
6-(methylamino)hexanamide;methyl 2-[1-ethoxy-4-methyl-3-[[(3S)-3-methylpentanoyl]-[(E)-pent-2-enyl]amino]pentyl]-1,3-thiazole-4-carboxylate (PubChem CID 145262629) has the molecular formula C31H56N4O5S and a molecular weight of 596.88 g/mol. Its IUPAC name is 6-(methylamino)hexanamide;methyl 2-[1-ethoxy-4-methyl-3-[[(3S)-3-methylpentanoyl]-[(E)-pent-2-enyl]amino]pentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | 6-(methylamino)hexanamide;methyl 2-[1-ethoxy-4-methyl-3-[[(3S)-3-methylpentanoyl]-[(E)-pent-2-enyl]amino]pentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 145262629 |
| Molecular Formula | C31H56N4O5S |
| Molecular Weight | 596.88 g/mol |
| Exact Mass | 596.40 |
| IUPAC Name | 6-(methylamino)hexanamide;methyl 2-[1-ethoxy-4-methyl-3-[[(3S)-3-methylpentanoyl]-[(E)-pent-2-enyl]amino]pentyl]-1,3-thiazole-4-carboxylate |
| SMILES | CC/C=C/CN(C(=O)C[C@@H](C)CC)C(CC(OCC)c1nc(C(=O)OC)cs1)C(C)C.CNCCCCCC(N)=O |
| InChI | InChI=1S/C24H40N2O4S.C7H16N2O/c1-8-11-12-13-26(22(27)14-18(6)9-2)20(17(4)5)15-21(30-10-3)23-25-19(16-31-23)24(28)29-7;1-9-6-4-2-3-5-7(8)10/h11-12,16-18,20-21H,8-10,13-15H2,1-7H3;9H,2-6H2,1H3,(H2,8,10)/b12-11+;/t18-,20?,21?;/m0./s1 |
| InChIKey | XOBDXUJVVXCSNZ-VXCZXRMSSA-N |
| XLogP | 5.90 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.88 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|