C21H21F4N3O5 — CID 145267079
pentyl 2-[7-fluoro-6-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]-3-oxo-1,4-benzoxazin-4-yl]acetate (PubChem CID 145267079) has the molecular formula C21H21F4N3O5 and a molecular weight of 471.41 g/mol. Its IUPAC name is pentyl 2-[7-fluoro-6-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]-3-oxo-1,4-benzoxazin-4-yl]acetate.
| Compound Name | pentyl 2-[7-fluoro-6-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]-3-oxo-1,4-benzoxazin-4-yl]acetate |
|---|---|
| PubChem CID | 145267079 |
| Molecular Formula | C21H21F4N3O5 |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | pentyl 2-[7-fluoro-6-[1-methyl-4-oxo-6-(trifluoromethyl)pyridazin-3-yl]-3-oxo-1,4-benzoxazin-4-yl]acetate |
| SMILES | CCCCCOC(=O)CN1C(=O)COc2cc(F)c(-c3nn(C)c(C(F)(F)F)cc3=O)cc21 |
| InChI | InChI=1S/C21H21F4N3O5/c1-3-4-5-6-32-19(31)10-28-14-7-12(13(22)8-16(14)33-11-18(28)30)20-15(29)9-17(21(23,24)25)27(2)26-20/h7-9H,3-6,10-11H2,1-2H3 |
| InChIKey | MSWCWOPIMOJLKB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|