C9H9NS — CID 145296574
3-methyl-7H-cyclohepta[d][1,2]thiazole (PubChem CID 145296574) has the molecular formula C9H9NS and a molecular weight of 163.24 g/mol. Its IUPAC name is 3-methyl-7H-cyclohepta[d][1,2]thiazole.
| Compound Name | 3-methyl-7H-cyclohepta[d][1,2]thiazole |
|---|---|
| PubChem CID | 145296574 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 3-methyl-7H-cyclohepta[d][1,2]thiazole |
| SMILES | Cc1nsc2c1=CC=CCC=2 |
| InChI | InChI=1S/C9H9NS/c1-7-8-5-3-2-4-6-9(8)11-10-7/h2-3,5-6H,4H2,1H3 |
| InChIKey | UUZWTQFBNQEIBH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |