About (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole
(4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole (PubChem CID 139436605) has the molecular formula C11H15NS
and a molecular weight of 193.31 g/mol. Its IUPAC name is (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole.
Molecular Properties
| Compound Name | (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole |
| PubChem CID | 139436605 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole |
| SMILES | C=C/C=c1/c(C(C)C)ns/c1=C/C |
| InChI | InChI=1S/C11H15NS/c1-5-7-9-10(6-2)13-12-11(9)8(3)4/h5-8H,1H2,2-4H3/b9-7+,10-6+ |
| InChIKey | WXNTYUBHTMNSHX-IDXDHNASSA-N |
| XLogP | 2.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole?
The IUPAC name of (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole (CID 139436605) is (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole.
What is the SMILES notation for (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole?
The canonical SMILES for (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole is C=C/C=c1/c(C(C)C)ns/c1=C/C.
What is the InChIKey of (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole?
The InChIKey is WXNTYUBHTMNSHX-IDXDHNASSA-N. The full InChI is InChI=1S/C11H15NS/c1-5-7-9-10(6-2)13-12-11(9)8(3)4/h5-8H,1H2,2-4H3/b9-7+,10-6+.
What are the key properties of (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole?
(4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole has a molecular weight of 193.31 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,5E)-5-ethylidene-3-propan-2-yl-4-prop-2-enylidene-1,2-thiazole is sourced from PubChem (CID 139436605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).