C12H20N2S — CID 145296719
2,3-dihydro-1H-indol-6-amine;2-methylpropane-2-thiol (PubChem CID 145296719) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-6-amine;2-methylpropane-2-thiol.
| Compound Name | 2,3-dihydro-1H-indol-6-amine;2-methylpropane-2-thiol |
|---|---|
| PubChem CID | 145296719 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2,3-dihydro-1H-indol-6-amine;2-methylpropane-2-thiol |
| SMILES | CC(C)(C)S.Nc1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C8H10N2.C4H10S/c9-7-2-1-6-3-4-10-8(6)5-7;1-4(2,3)5/h1-2,5,10H,3-4,9H2;5H,1-3H3 |
| InChIKey | UFLWCUVIYWRHCC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|