C16H21N3 — CID 174805815
3-methylaniline;1,2,3,4-tetrahydroquinolin-7-amine (PubChem CID 174805815) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 3-methylaniline;1,2,3,4-tetrahydroquinolin-7-amine.
| Compound Name | 3-methylaniline;1,2,3,4-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 174805815 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3-methylaniline;1,2,3,4-tetrahydroquinolin-7-amine |
| SMILES | Cc1cccc(N)c1.Nc1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C9H12N2.C7H9N/c10-8-4-3-7-2-1-5-11-9(7)6-8;1-6-3-2-4-7(8)5-6/h3-4,6,11H,1-2,5,10H2;2-5H,8H2,1H3 |
| InChIKey | XOOSRRCNZUEPHN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|