C21H21F4N7O — CID 145325319
N-[(5S,8S)-3-(3-fluoro-4-pyridinyl)-1-methanimidoyl-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 145325319) has the molecular formula C21H21F4N7O and a molecular weight of 463.44 g/mol. Its IUPAC name is N-[(5S,8S)-3-(3-fluoro-4-pyridinyl)-1-methanimidoyl-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(5S,8S)-3-(3-fluoro-4-pyridinyl)-1-methanimidoyl-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 145325319 |
| Molecular Formula | C21H21F4N7O |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[(5S,8S)-3-(3-fluoro-4-pyridinyl)-1-methanimidoyl-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | [H]/N=C/C12CC[C@@H](CN(c3ccncc3F)C1)[C@@H]2Nc1nc2c(OCC(F)(F)F)cccn2n1 |
| InChI | InChI=1S/C21H21F4N7O/c22-14-8-27-6-4-15(14)31-9-13-3-5-20(10-26,11-31)17(13)28-19-29-18-16(33-12-21(23,24)25)2-1-7-32(18)30-19/h1-2,4,6-8,10,13,17,26H,3,5,9,11-12H2,(H,28,30)/b26-10+/t13-,17-,20?/m0/s1 |
| InChIKey | TXENEFUHGQZLKE-YKQXPKMRSA-N |
| XLogP | 3.55 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|