C22H29BF3NO4 — CID 145329211
5,5,5-trifluoro-N-[(3R)-2-hydroxy-8-(8-oxonon-1-en-2-yl)-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide (PubChem CID 145329211) has the molecular formula C22H29BF3NO4 and a molecular weight of 439.28 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-[(3R)-2-hydroxy-8-(8-oxonon-1-en-2-yl)-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide.
| Compound Name | 5,5,5-trifluoro-N-[(3R)-2-hydroxy-8-(8-oxonon-1-en-2-yl)-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide |
|---|---|
| PubChem CID | 145329211 |
| Molecular Formula | C22H29BF3NO4 |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 5,5,5-trifluoro-N-[(3R)-2-hydroxy-8-(8-oxonon-1-en-2-yl)-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanamide |
| SMILES | C=C(CCCCCC(C)=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCCC(F)(F)F)C2 |
| InChI | InChI=1S/C22H29BF3NO4/c1-15(8-4-3-5-9-16(2)28)18-11-6-10-17-14-19(23(30)31-21(17)18)27-20(29)12-7-13-22(24,25)26/h6,10-11,19,30H,1,3-5,7-9,12-14H2,2H3,(H,27,29)/t19-/m0/s1 |
| InChIKey | ZYFOUALBFAHZLS-IBGZPJMESA-N |
| XLogP | 4.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|