C36H33BN6O2 — CID 145340547
2-[3-(8-cyclohexa-1,3-dien-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-phenyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 145340547) has the molecular formula C36H33BN6O2 and a molecular weight of 592.51 g/mol. Its IUPAC name is 2-[3-(8-cyclohexa-1,3-dien-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-phenyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[3-(8-cyclohexa-1,3-dien-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-phenyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 145340547 |
| Molecular Formula | C36H33BN6O2 |
| Molecular Weight | 592.51 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 2-[3-(8-cyclohexa-1,3-dien-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-phenyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC1(C)OB(c2cc(-c3nc4c(C5=CC=CCC5)cccn4n3)cc(-c3nc4c(-c5ccccc5)cccn4n3)c2)OC1(C)C |
| InChI | InChI=1S/C36H33BN6O2/c1-35(2)36(3,4)45-37(44-35)28-22-26(31-38-33-29(17-11-19-42(33)40-31)24-13-7-5-8-14-24)21-27(23-28)32-39-34-30(18-12-20-43(34)41-32)25-15-9-6-10-16-25/h5-9,11-15,17-23H,10,16H2,1-4H3 |
| InChIKey | BSIGOCOMAOVCQS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|