About (1-amino-2-cyanoethenyl) piperazine-1-carboxylate
(1-amino-2-cyanoethenyl) piperazine-1-carboxylate (PubChem CID 145343574) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is (1-amino-2-cyanoethenyl) piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (1-amino-2-cyanoethenyl) piperazine-1-carboxylate |
| PubChem CID | 145343574 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (1-amino-2-cyanoethenyl) piperazine-1-carboxylate |
| SMILES | N#CC=C(N)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C8H12N4O2/c9-2-1-7(10)14-8(13)12-5-3-11-4-6-12/h1,11H,3-6,10H2 |
| InChIKey | IBKQGJPKYGAGTF-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-2-cyanoethenyl) piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-2-cyanoethenyl) piperazine-1-carboxylate?
The IUPAC name of (1-amino-2-cyanoethenyl) piperazine-1-carboxylate (CID 145343574) is (1-amino-2-cyanoethenyl) piperazine-1-carboxylate.
What is the SMILES notation for (1-amino-2-cyanoethenyl) piperazine-1-carboxylate?
The canonical SMILES for (1-amino-2-cyanoethenyl) piperazine-1-carboxylate is N#CC=C(N)OC(=O)N1CCNCC1.
What is the InChIKey of (1-amino-2-cyanoethenyl) piperazine-1-carboxylate?
The InChIKey is IBKQGJPKYGAGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c9-2-1-7(10)14-8(13)12-5-3-11-4-6-12/h1,11H,3-6,10H2.
What are the key properties of (1-amino-2-cyanoethenyl) piperazine-1-carboxylate?
(1-amino-2-cyanoethenyl) piperazine-1-carboxylate has a molecular weight of 196.21 g/mol, XLogP of -0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-2-cyanoethenyl) piperazine-1-carboxylate is sourced from PubChem (CID 145343574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).