C11H15N — CID 145352283
8-methyl-2-azabicyclo[4.4.1]undeca-1(10),6,8-triene (PubChem CID 145352283) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 8-methyl-2-azabicyclo[4.4.1]undeca-1(10),6,8-triene.
| Compound Name | 8-methyl-2-azabicyclo[4.4.1]undeca-1(10),6,8-triene |
|---|---|
| PubChem CID | 145352283 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 8-methyl-2-azabicyclo[4.4.1]undeca-1(10),6,8-triene |
| SMILES | CC1=CC=C2CC(=C1)CCCN2 |
| InChI | InChI=1S/C11H15N/c1-9-4-5-11-8-10(7-9)3-2-6-12-11/h4-5,7,12H,2-3,6,8H2,1H3 |
| InChIKey | RPRLQYBFNJYTDC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |