C38H42Cl2N4O4 — CID 145363595
3-[1-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-formyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]butan-2-yl-methylamino]benzoic acid (PubChem CID 145363595) has the molecular formula C38H42Cl2N4O4 and a molecular weight of 689.68 g/mol. Its IUPAC name is 3-[1-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-formyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]butan-2-yl-methylamino]benzoic acid.
| Compound Name | 3-[1-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-formyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]butan-2-yl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 145363595 |
| Molecular Formula | C38H42Cl2N4O4 |
| Molecular Weight | 689.68 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | 3-[1-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-formyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]butan-2-yl-methylamino]benzoic acid |
| SMILES | CCC(Cn1c(C=O)c(CCCOc2cc(C)c(Cl)c(C)c2)c2ccc(Cl)c(-c3c(C)nn(C)c3C)c21)N(C)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C38H42Cl2N4O4/c1-8-27(42(6)28-12-9-11-26(19-28)38(46)47)20-44-33(21-45)30(13-10-16-48-29-17-22(2)36(40)23(3)18-29)31-14-15-32(39)35(37(31)44)34-24(4)41-43(7)25(34)5/h9,11-12,14-15,17-19,21,27H,8,10,13,16,20H2,1-7H3,(H,46,47) |
| InChIKey | ICDZREFCNPRBJX-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.68 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|