C11H16F7N — CID 145366202
ethane;1-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]-4-(trifluoromethyl)piperidine (PubChem CID 145366202) has the molecular formula C11H16F7N and a molecular weight of 295.24 g/mol. Its IUPAC name is ethane;1-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]-4-(trifluoromethyl)piperidine.
| Compound Name | ethane;1-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 145366202 |
| Molecular Formula | C11H16F7N |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | ethane;1-[(Z)-1,3,3,3-tetrafluoroprop-1-enyl]-4-(trifluoromethyl)piperidine |
| SMILES | CC.F/C(=C\C(F)(F)F)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H10F7N.C2H6/c10-7(5-8(11,12)13)17-3-1-6(2-4-17)9(14,15)16;1-2/h5-6H,1-4H2;1-2H3/b7-5+; |
| InChIKey | RTMBMNBXSOMEFC-GZOLSCHFSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|