C21H23ClF3NO2S — CID 145366720
4-chloro-3-sulfanyl-N-(3,4,5-trifluoro-2-methylphenyl)benzamide;4-methylcyclohexan-1-ol (PubChem CID 145366720) has the molecular formula C21H23ClF3NO2S and a molecular weight of 445.93 g/mol. Its IUPAC name is 4-chloro-3-sulfanyl-N-(3,4,5-trifluoro-2-methylphenyl)benzamide;4-methylcyclohexan-1-ol.
| Compound Name | 4-chloro-3-sulfanyl-N-(3,4,5-trifluoro-2-methylphenyl)benzamide;4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 145366720 |
| Molecular Formula | C21H23ClF3NO2S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 4-chloro-3-sulfanyl-N-(3,4,5-trifluoro-2-methylphenyl)benzamide;4-methylcyclohexan-1-ol |
| SMILES | CC1CCC(O)CC1.Cc1c(NC(=O)c2ccc(Cl)c(S)c2)cc(F)c(F)c1F |
| InChI | InChI=1S/C14H9ClF3NOS.C7H14O/c1-6-10(5-9(16)13(18)12(6)17)19-14(20)7-2-3-8(15)11(21)4-7;1-6-2-4-7(8)5-3-6/h2-5,21H,1H3,(H,19,20);6-8H,2-5H2,1H3 |
| InChIKey | QKQJENGBQUFLBP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|