C29H35ClF3N3O2S2 — CID 145366725
4-chloro-3-sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;2-ethyl-6-methylcyclohexan-1-ol;S-(1-pyridin-3-ylethyl)thiohydroxylamine (PubChem CID 145366725) has the molecular formula C29H35ClF3N3O2S2 and a molecular weight of 614.20 g/mol. Its IUPAC name is 4-chloro-3-sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;2-ethyl-6-methylcyclohexan-1-ol;S-(1-pyridin-3-ylethyl)thiohydroxylamine.
| Compound Name | 4-chloro-3-sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;2-ethyl-6-methylcyclohexan-1-ol;S-(1-pyridin-3-ylethyl)thiohydroxylamine |
|---|---|
| PubChem CID | 145366725 |
| Molecular Formula | C29H35ClF3N3O2S2 |
| Molecular Weight | 614.20 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 4-chloro-3-sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;2-ethyl-6-methylcyclohexan-1-ol;S-(1-pyridin-3-ylethyl)thiohydroxylamine |
| SMILES | CC(SN)c1cccnc1.CCC1CCCC(C)C1O.O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(S)c1 |
| InChI | InChI=1S/C13H7ClF3NOS.C9H18O.C7H10N2S/c14-8-2-1-6(3-11(8)20)13(19)18-7-4-9(15)12(17)10(16)5-7;1-3-8-6-4-5-7(2)9(8)10;1-6(10-8)7-3-2-4-9-5-7/h1-5,20H,(H,18,19);7-10H,3-6H2,1-2H3;2-6H,8H2,1H3 |
| InChIKey | OXJHQPRXBGENOQ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.20 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|