C28H28ClF3N2O4S — CID 166671909
4-chloro-3-[1-[(2R,5S)-2-hydroxy-3,5-dimethyl-2-pyridin-3-ylcyclopentyl]propan-2-ylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 166671909) has the molecular formula C28H28ClF3N2O4S and a molecular weight of 581.06 g/mol. Its IUPAC name is 4-chloro-3-[1-[(2R,5S)-2-hydroxy-3,5-dimethyl-2-pyridin-3-ylcyclopentyl]propan-2-ylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[1-[(2R,5S)-2-hydroxy-3,5-dimethyl-2-pyridin-3-ylcyclopentyl]propan-2-ylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 166671909 |
| Molecular Formula | C28H28ClF3N2O4S |
| Molecular Weight | 581.06 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 4-chloro-3-[1-[(2R,5S)-2-hydroxy-3,5-dimethyl-2-pyridin-3-ylcyclopentyl]propan-2-ylsulfonyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC1C[C@H](C)C(CC(C)S(=O)(=O)c2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)[C@@]1(O)c1cccnc1 |
| InChI | InChI=1S/C28H28ClF3N2O4S/c1-15-9-16(2)28(36,19-5-4-8-33-14-19)21(15)10-17(3)39(37,38)25-11-18(6-7-22(25)29)27(35)34-20-12-23(30)26(32)24(31)13-20/h4-8,11-17,21,36H,9-10H2,1-3H3,(H,34,35)/t15-,16?,17?,21?,28-/m0/s1 |
| InChIKey | KDGIQNYDSAKUKH-KOPZNLTRSA-N |
| XLogP | 6.14 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.06 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|