C6H13N5O — CID 145368026
3-amino-6-(aminomethyl)-4H-1,2,4-triazin-5-one;ethane (PubChem CID 145368026) has the molecular formula C6H13N5O and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-amino-6-(aminomethyl)-4H-1,2,4-triazin-5-one;ethane.
| Compound Name | 3-amino-6-(aminomethyl)-4H-1,2,4-triazin-5-one;ethane |
|---|---|
| PubChem CID | 145368026 |
| Molecular Formula | C6H13N5O |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 3-amino-6-(aminomethyl)-4H-1,2,4-triazin-5-one;ethane |
| SMILES | CC.NCc1nnc(N)[nH]c1=O |
| InChI | InChI=1S/C4H7N5O.C2H6/c5-1-2-3(10)7-4(6)9-8-2;1-2/h1,5H2,(H3,6,7,9,10);1-2H3 |
| InChIKey | VZGOLXILJTXNAL-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |