C12H14N2O3S — CID 145377897
1'-methylsulfonylspiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 145377897) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 1'-methylsulfonylspiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | 1'-methylsulfonylspiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 145377897 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1'-methylsulfonylspiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | CS(=O)(=O)N1CCCC12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C12H14N2O3S/c1-18(16,17)14-8-4-7-12(14)9-5-2-3-6-10(9)13-11(12)15/h2-3,5-6H,4,7-8H2,1H3,(H,13,15) |
| InChIKey | FVSSYZCIGBJRTK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |