About CID 145383869
CID 145383869 (PubChem CID 145383869) has the molecular formula C9H11Ga
and a molecular weight of 188.91 g/mol.
Molecular Properties
| Compound Name | CID 145383869 |
| PubChem CID | 145383869 |
| Molecular Formula | C9H11Ga |
| Molecular Weight | 188.91 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccc([Ga])cc1 |
| InChI | InChI=1S/C9H11.Ga/c1-8(2)9-6-4-3-5-7-9;/h4-8H,1-2H3; |
| InChIKey | IPDVIATVVPNZBY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.91 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 145383869 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145383869?
The IUPAC name of CID 145383869 (CID 145383869) is not available.
What is the SMILES notation for CID 145383869?
The canonical SMILES for CID 145383869 is CC(C)c1ccc([Ga])cc1.
What is the InChIKey of CID 145383869?
The InChIKey is IPDVIATVVPNZBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11.Ga/c1-8(2)9-6-4-3-5-7-9;/h4-8H,1-2H3;.
What are the key properties of CID 145383869?
CID 145383869 has a molecular weight of 188.91 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145383869 is sourced from PubChem (CID 145383869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).