C18H20N4OS — CID 145384761
N,N'-diamino-3-[4-(1-benzothiophen-5-ylmethoxy)phenyl]propanimidamide (PubChem CID 145384761) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is N,N'-diamino-3-[4-(1-benzothiophen-5-ylmethoxy)phenyl]propanimidamide.
| Compound Name | N,N'-diamino-3-[4-(1-benzothiophen-5-ylmethoxy)phenyl]propanimidamide |
|---|---|
| PubChem CID | 145384761 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N,N'-diamino-3-[4-(1-benzothiophen-5-ylmethoxy)phenyl]propanimidamide |
| SMILES | N/N=C(/CCc1ccc(OCc2ccc3sccc3c2)cc1)NN |
| InChI | InChI=1S/C18H20N4OS/c19-21-18(22-20)8-4-13-1-5-16(6-2-13)23-12-14-3-7-17-15(11-14)9-10-24-17/h1-3,5-7,9-11H,4,8,12,19-20H2,(H,21,22) |
| InChIKey | CWEXIOKNPYIAGB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|