C27H29N5OS — CID 145384749
N,N'-diamino-3-[4-[[3-(2-methylphenyl)thieno[2,3-b]pyridin-5-yl]methoxy]phenyl]propanimidamide;prop-1-yne (PubChem CID 145384749) has the molecular formula C27H29N5OS and a molecular weight of 471.63 g/mol. Its IUPAC name is N,N'-diamino-3-[4-[[3-(2-methylphenyl)thieno[2,3-b]pyridin-5-yl]methoxy]phenyl]propanimidamide;prop-1-yne.
| Compound Name | N,N'-diamino-3-[4-[[3-(2-methylphenyl)thieno[2,3-b]pyridin-5-yl]methoxy]phenyl]propanimidamide;prop-1-yne |
|---|---|
| PubChem CID | 145384749 |
| Molecular Formula | C27H29N5OS |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N,N'-diamino-3-[4-[[3-(2-methylphenyl)thieno[2,3-b]pyridin-5-yl]methoxy]phenyl]propanimidamide;prop-1-yne |
| SMILES | C#CC.Cc1ccccc1-c1csc2ncc(COc3ccc(CC/C(=N/N)NN)cc3)cc12 |
| InChI | InChI=1S/C24H25N5OS.C3H4/c1-16-4-2-3-5-20(16)22-15-31-24-21(22)12-18(13-27-24)14-30-19-9-6-17(7-10-19)8-11-23(28-25)29-26;1-3-2/h2-7,9-10,12-13,15H,8,11,14,25-26H2,1H3,(H,28,29);1H,2H3 |
| InChIKey | GSEXACKCXVNROE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|